C8H17NO5P2 — CID 101196354
N-cycloheptyl-2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-amine (PubChem CID 101196354) has the molecular formula C8H17NO5P2 and a molecular weight of 269.17 g/mol. Its IUPAC name is N-cycloheptyl-2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-amine.
| Compound Name | N-cycloheptyl-2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-amine |
|---|---|
| PubChem CID | 101196354 |
| Molecular Formula | C8H17NO5P2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N-cycloheptyl-2,4-dihydroxy-2,4-dioxo-1,2λ5,4λ5-oxadiphosphetan-3-amine |
| SMILES | O=P1(O)OP(=O)(O)C1NC1CCCCCC1 |
| InChI | InChI=1S/C8H17NO5P2/c10-15(11)8(16(12,13)14-15)9-7-5-3-1-2-4-6-7/h7-9H,1-6H2,(H,10,11)(H,12,13) |
| InChIKey | ZOICPVVENBUTKU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|