C10H19NO2 — CID 21150559
(2S,3S)-3-piperidin-1-yloxan-2-ol (PubChem CID 21150559) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (2S,3S)-3-piperidin-1-yloxan-2-ol.
| Compound Name | (2S,3S)-3-piperidin-1-yloxan-2-ol |
|---|---|
| PubChem CID | 21150559 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (2S,3S)-3-piperidin-1-yloxan-2-ol |
| SMILES | O[C@H]1OCCC[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C10H19NO2/c12-10-9(5-4-8-13-10)11-6-2-1-3-7-11/h9-10,12H,1-8H2/t9-,10-/m0/s1 |
| InChIKey | TUDRSNJFVAEAMQ-UWVGGRQHSA-N |
| XLogP | 0.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |