About di(cyclobutyl)methanone;trihydrochloride
di(cyclobutyl)methanone;trihydrochloride (PubChem CID 174768211) has the molecular formula C9H17Cl3O
and a molecular weight of 247.59 g/mol. Its IUPAC name is di(cyclobutyl)methanone;trihydrochloride.
Molecular Properties
| Compound Name | di(cyclobutyl)methanone;trihydrochloride |
| PubChem CID | 174768211 |
| Molecular Formula | C9H17Cl3O |
| Molecular Weight | 247.59 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | di(cyclobutyl)methanone;trihydrochloride |
| SMILES | Cl.Cl.Cl.O=C(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C9H14O.3ClH/c10-9(7-3-1-4-7)8-5-2-6-8;;;/h7-8H,1-6H2;3*1H |
| InChIKey | AICUBXASNMXLTC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze di(cyclobutyl)methanone;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclobutyl)methanone;trihydrochloride?
The IUPAC name of di(cyclobutyl)methanone;trihydrochloride (CID 174768211) is di(cyclobutyl)methanone;trihydrochloride.
What is the SMILES notation for di(cyclobutyl)methanone;trihydrochloride?
The canonical SMILES for di(cyclobutyl)methanone;trihydrochloride is Cl.Cl.Cl.O=C(C1CCC1)C1CCC1.
What is the InChIKey of di(cyclobutyl)methanone;trihydrochloride?
The InChIKey is AICUBXASNMXLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.3ClH/c10-9(7-3-1-4-7)8-5-2-6-8;;;/h7-8H,1-6H2;3*1H.
What are the key properties of di(cyclobutyl)methanone;trihydrochloride?
di(cyclobutyl)methanone;trihydrochloride has a molecular weight of 247.59 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclobutyl)methanone;trihydrochloride is sourced from PubChem (CID 174768211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).