About cyclohexanol;dicyclohexylmethanone
cyclohexanol;dicyclohexylmethanone (PubChem CID 174532304) has the molecular formula C19H34O2
and a molecular weight of 294.48 g/mol. Its IUPAC name is cyclohexanol;dicyclohexylmethanone.
Molecular Properties
| Compound Name | cyclohexanol;dicyclohexylmethanone |
| PubChem CID | 174532304 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | cyclohexanol;dicyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)C1CCCCC1.OC1CCCCC1 |
| InChI | InChI=1S/C13H22O.C6H12O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h11-12H,1-10H2;6-7H,1-5H2 |
| InChIKey | GCIXDTFRLXXFBH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexanol;dicyclohexylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;dicyclohexylmethanone?
The IUPAC name of cyclohexanol;dicyclohexylmethanone (CID 174532304) is cyclohexanol;dicyclohexylmethanone.
What is the SMILES notation for cyclohexanol;dicyclohexylmethanone?
The canonical SMILES for cyclohexanol;dicyclohexylmethanone is O=C(C1CCCCC1)C1CCCCC1.OC1CCCCC1.
What is the InChIKey of cyclohexanol;dicyclohexylmethanone?
The InChIKey is GCIXDTFRLXXFBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O.C6H12O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h11-12H,1-10H2;6-7H,1-5H2.
What are the key properties of cyclohexanol;dicyclohexylmethanone?
cyclohexanol;dicyclohexylmethanone has a molecular weight of 294.48 g/mol, XLogP of 5.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;dicyclohexylmethanone is sourced from PubChem (CID 174532304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).