About di(cyclobutyl)methanone
di(cyclobutyl)methanone (PubChem CID 15444458) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is di(cyclobutyl)methanone.
Molecular Properties
| Compound Name | di(cyclobutyl)methanone |
| PubChem CID | 15444458 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | di(cyclobutyl)methanone |
| SMILES | O=C(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C9H14O/c10-9(7-3-1-4-7)8-5-2-6-8/h7-8H,1-6H2 |
| InChIKey | KMBSDQLXYYUBAS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze di(cyclobutyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclobutyl)methanone?
The IUPAC name of di(cyclobutyl)methanone (CID 15444458) is di(cyclobutyl)methanone.
What is the SMILES notation for di(cyclobutyl)methanone?
The canonical SMILES for di(cyclobutyl)methanone is O=C(C1CCC1)C1CCC1.
What is the InChIKey of di(cyclobutyl)methanone?
The InChIKey is KMBSDQLXYYUBAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c10-9(7-3-1-4-7)8-5-2-6-8/h7-8H,1-6H2.
What are the key properties of di(cyclobutyl)methanone?
di(cyclobutyl)methanone has a molecular weight of 138.21 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclobutyl)methanone is sourced from PubChem (CID 15444458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).