C8H15O2P — CID 130756776
(1R,5S,6R,8R)-8-methyl-8-oxo-8λ5-phosphabicyclo[3.2.1]octan-6-ol (PubChem CID 130756776) has the molecular formula C8H15O2P and a molecular weight of 174.18 g/mol. Its IUPAC name is (1R,5S,6R,8R)-8-methyl-8-oxo-8λ5-phosphabicyclo[3.2.1]octan-6-ol.
| Compound Name | (1R,5S,6R,8R)-8-methyl-8-oxo-8λ5-phosphabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 130756776 |
| Molecular Formula | C8H15O2P |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (1R,5S,6R,8R)-8-methyl-8-oxo-8λ5-phosphabicyclo[3.2.1]octan-6-ol |
| SMILES | C[P@@]1(=O)[C@@H]2CCC[C@H]1[C@H](O)C2 |
| InChI | InChI=1S/C8H15O2P/c1-11(10)6-3-2-4-8(11)7(9)5-6/h6-9H,2-5H2,1H3/t6-,7-,8+,11-/m1/s1 |
| InChIKey | WFQXIPBUJSMJTE-HGIWHZBTSA-N |
| XLogP | 1.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|