C9H16O2 — CID 130891181
(3aR,5R,6S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol (PubChem CID 130891181) has the molecular formula C9H16O2 and a molecular weight of 156.23 g/mol. Its IUPAC name is (3aR,5R,6S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol.
| Compound Name | (3aR,5R,6S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol |
|---|---|
| PubChem CID | 130891181 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (3aR,5R,6S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol |
| SMILES | O[C@@H]1C[C@H]2CCC[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C9H16O2/c10-8-4-6-2-1-3-7(6)5-9(8)11/h6-11H,1-5H2/t6-,7+,8-,9+ |
| InChIKey | DRSQPFOPSKFTLI-SPJNRGJMSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |