C16H28O — CID 98536249
(2S,3S,4aS,8aR)-3-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol (PubChem CID 98536249) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (2S,3S,4aS,8aR)-3-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
| Compound Name | (2S,3S,4aS,8aR)-3-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 98536249 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (2S,3S,4aS,8aR)-3-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
| SMILES | O[C@H]1C[C@H]2CCCC[C@H]2C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C16H28O/c17-16-11-14-9-5-4-8-13(14)10-15(16)12-6-2-1-3-7-12/h12-17H,1-11H2/t13-,14+,15-,16-/m0/s1 |
| InChIKey | PEYQURPOCQODNT-FZKCQIBNSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |