C18H30O2 — CID 170528023
(2R,5R)-2,5-dicyclopentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol (PubChem CID 170528023) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (2R,5R)-2,5-dicyclopentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol.
| Compound Name | (2R,5R)-2,5-dicyclopentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol |
|---|---|
| PubChem CID | 170528023 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (2R,5R)-2,5-dicyclopentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol |
| SMILES | OC1C2C(C[C@@H]1C1CCCC1)C[C@H](C1CCCC1)C2O |
| InChI | InChI=1S/C18H30O2/c19-17-14(11-5-1-2-6-11)9-13-10-15(18(20)16(13)17)12-7-3-4-8-12/h11-20H,1-10H2/t13?,14-,15-,16?,17?,18?/m1/s1 |
| InChIKey | LDNSHOAUEQKRPR-SDDMPUBXSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |