C17H30O2 — CID 170527431
(3R,6R)-6-cyclopentyl-3-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol (PubChem CID 170527431) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (3R,6R)-6-cyclopentyl-3-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol.
| Compound Name | (3R,6R)-6-cyclopentyl-3-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol |
|---|---|
| PubChem CID | 170527431 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (3R,6R)-6-cyclopentyl-3-methyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol |
| SMILES | C[C@@H]1CCC2CCC[C@H](C3CCCC3)C(O)C2C1O |
| InChI | InChI=1S/C17H30O2/c1-11-9-10-13-7-4-8-14(12-5-2-3-6-12)17(19)15(13)16(11)18/h11-19H,2-10H2,1H3/t11-,13?,14-,15?,16?,17?/m1/s1 |
| InChIKey | CNZRSXJVYBXMOP-XZJFDMMHSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |