H4BNO4P — CID 173204906
CID 173204906 (PubChem CID 173204906) has the molecular formula H4BNO4P and a molecular weight of 123.82 g/mol.
| Compound Name | CID 173204906 |
|---|---|
| PubChem CID | 173204906 |
| Molecular Formula | H4BNO4P |
| Molecular Weight | 123.82 g/mol |
| Exact Mass | 124.00 |
| IUPAC Name | — |
| SMILES | N.O=P1(O)O[B]O1 |
| InChI | InChI=1S/BHO4P.H3N/c2-6(3)4-1-5-6;/h(H,2,3);1H3 |
| InChIKey | AFHNQTRDUMAOEH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.82 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|