C2H5O11P — CID 88624800
9-hydroxy-1,2,3,4,5,6,7,8,10-nonaoxa-9λ5-phosphacyclododecane 9-oxide (PubChem CID 88624800) has the molecular formula C2H5O11P and a molecular weight of 236.02 g/mol. Its IUPAC name is 9-hydroxy-1,2,3,4,5,6,7,8,10-nonaoxa-9λ5-phosphacyclododecane 9-oxide.
| Compound Name | 9-hydroxy-1,2,3,4,5,6,7,8,10-nonaoxa-9λ5-phosphacyclododecane 9-oxide |
|---|---|
| PubChem CID | 88624800 |
| Molecular Formula | C2H5O11P |
| Molecular Weight | 236.02 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 9-hydroxy-1,2,3,4,5,6,7,8,10-nonaoxa-9λ5-phosphacyclododecane 9-oxide |
| SMILES | O=P1(O)OCCOOOOOOOO1 |
| InChI | InChI=1S/C2H5O11P/c3-14(4)6-2-1-5-7-8-9-10-11-12-13-14/h1-2H2,(H,3,4) |
| InChIKey | GVDDJMCVSGFWTE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.02 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|