C16H29Cl4O5P — CID 87150031
4,4,5,5-tetrakis(1-chloropropan-2-yl)-2-hydroxy-1,3,6,2λ5-trioxaphosphocane 2-oxide (PubChem CID 87150031) has the molecular formula C16H29Cl4O5P and a molecular weight of 474.19 g/mol. Its IUPAC name is 4,4,5,5-tetrakis(1-chloropropan-2-yl)-2-hydroxy-1,3,6,2λ5-trioxaphosphocane 2-oxide.
| Compound Name | 4,4,5,5-tetrakis(1-chloropropan-2-yl)-2-hydroxy-1,3,6,2λ5-trioxaphosphocane 2-oxide |
|---|---|
| PubChem CID | 87150031 |
| Molecular Formula | C16H29Cl4O5P |
| Molecular Weight | 474.19 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 4,4,5,5-tetrakis(1-chloropropan-2-yl)-2-hydroxy-1,3,6,2λ5-trioxaphosphocane 2-oxide |
| SMILES | CC(CCl)C1(C(C)CCl)OCCOP(=O)(O)OC1(C(C)CCl)C(C)CCl |
| InChI | InChI=1S/C16H29Cl4O5P/c1-11(7-17)15(12(2)8-18)16(13(3)9-19,14(4)10-20)25-26(21,22)24-6-5-23-15/h11-14H,5-10H2,1-4H3,(H,21,22) |
| InChIKey | IJIRMYQSPPIXES-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|