C11H17F6O4P — CID 154509022
4,5,5,6,6,7-hexafluoro-2-hydroxy-4-propan-2-yl-1,3-dioxa-2λ5-phosphacycloundecane 2-oxide (PubChem CID 154509022) has the molecular formula C11H17F6O4P and a molecular weight of 358.22 g/mol. Its IUPAC name is 4,5,5,6,6,7-hexafluoro-2-hydroxy-4-propan-2-yl-1,3-dioxa-2λ5-phosphacycloundecane 2-oxide.
| Compound Name | 4,5,5,6,6,7-hexafluoro-2-hydroxy-4-propan-2-yl-1,3-dioxa-2λ5-phosphacycloundecane 2-oxide |
|---|---|
| PubChem CID | 154509022 |
| Molecular Formula | C11H17F6O4P |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4,5,5,6,6,7-hexafluoro-2-hydroxy-4-propan-2-yl-1,3-dioxa-2λ5-phosphacycloundecane 2-oxide |
| SMILES | CC(C)C1(F)OP(=O)(O)OCCCCC(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H17F6O4P/c1-7(2)10(15)11(16,17)9(13,14)8(12)5-3-4-6-20-22(18,19)21-10/h7-8H,3-6H2,1-2H3,(H,18,19) |
| InChIKey | UXSLOWZEGACDQZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|