C7H9F6O4P — CID 87919069
4,4,5,5,6,7-hexafluoro-2-hydroxy-7-propan-2-yl-1,3,2λ5-dioxaphosphepane 2-oxide (PubChem CID 87919069) has the molecular formula C7H9F6O4P and a molecular weight of 302.11 g/mol. Its IUPAC name is 4,4,5,5,6,7-hexafluoro-2-hydroxy-7-propan-2-yl-1,3,2λ5-dioxaphosphepane 2-oxide.
| Compound Name | 4,4,5,5,6,7-hexafluoro-2-hydroxy-7-propan-2-yl-1,3,2λ5-dioxaphosphepane 2-oxide |
|---|---|
| PubChem CID | 87919069 |
| Molecular Formula | C7H9F6O4P |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 4,4,5,5,6,7-hexafluoro-2-hydroxy-7-propan-2-yl-1,3,2λ5-dioxaphosphepane 2-oxide |
| SMILES | CC(C)C1(F)OP(=O)(O)OC(F)(F)C(F)(F)C1F |
| InChI | InChI=1S/C7H9F6O4P/c1-3(2)5(9)4(8)6(10,11)7(12,13)17-18(14,15)16-5/h3-4H,1-2H3,(H,14,15) |
| InChIKey | IDBDQNAXAQUKOQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|