C11H19F4N — CID 174284621
(3R,6S)-2,3,4,6-tetrafluoro-1,4-di(propan-2-yl)piperidine (PubChem CID 174284621) has the molecular formula C11H19F4N and a molecular weight of 241.27 g/mol. Its IUPAC name is (3R,6S)-2,3,4,6-tetrafluoro-1,4-di(propan-2-yl)piperidine.
| Compound Name | (3R,6S)-2,3,4,6-tetrafluoro-1,4-di(propan-2-yl)piperidine |
|---|---|
| PubChem CID | 174284621 |
| Molecular Formula | C11H19F4N |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (3R,6S)-2,3,4,6-tetrafluoro-1,4-di(propan-2-yl)piperidine |
| SMILES | CC(C)N1C(F)[C@H](F)C(F)(C(C)C)C[C@@H]1F |
| InChI | InChI=1S/C11H19F4N/c1-6(2)11(15)5-8(12)16(7(3)4)10(14)9(11)13/h6-10H,5H2,1-4H3/t8-,9+,10?,11?/m1/s1 |
| InChIKey | XAOVSFZBHMJYRW-MFQSTILNSA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|