C11H16O3 — CID 90112010
2-[2,4-bis(oxiran-2-yl)cyclopentyl]oxirane (PubChem CID 90112010) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[2,4-bis(oxiran-2-yl)cyclopentyl]oxirane.
| Compound Name | 2-[2,4-bis(oxiran-2-yl)cyclopentyl]oxirane |
|---|---|
| PubChem CID | 90112010 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-[2,4-bis(oxiran-2-yl)cyclopentyl]oxirane |
| SMILES | C1OC1C1CC(C2CO2)C(C2CO2)C1 |
| InChI | InChI=1S/C11H16O3/c1-6(9-3-12-9)2-8(11-5-14-11)7(1)10-4-13-10/h6-11H,1-5H2 |
| InChIKey | UNNXTLWDNSLXQA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|