C5H8O2 — CID 130756816
(1R,5S)-3-oxabicyclo[3.1.0]hexan-2-ol (PubChem CID 130756816) has the molecular formula C5H8O2 and a molecular weight of 100.12 g/mol. Its IUPAC name is (1R,5S)-3-oxabicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,5S)-3-oxabicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 130756816 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | (1R,5S)-3-oxabicyclo[3.1.0]hexan-2-ol |
| SMILES | OC1OC[C@H]2C[C@@H]12 |
| InChI | InChI=1S/C5H8O2/c6-5-4-1-3(4)2-7-5/h3-6H,1-2H2/t3-,4-,5?/m1/s1 |
| InChIKey | NFIBXDLQBNOODK-ZZKAVYKESA-N |
| XLogP | -0.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |