C11H18O4 — CID 101444272
(3aS,4aS,7R,7aR,8aR)-2,2-dimethyl-3a,4,4a,5,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f][2]benzofuran-7-ol (PubChem CID 101444272) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3aS,4aS,7R,7aR,8aR)-2,2-dimethyl-3a,4,4a,5,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f][2]benzofuran-7-ol.
| Compound Name | (3aS,4aS,7R,7aR,8aR)-2,2-dimethyl-3a,4,4a,5,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f][2]benzofuran-7-ol |
|---|---|
| PubChem CID | 101444272 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (3aS,4aS,7R,7aR,8aR)-2,2-dimethyl-3a,4,4a,5,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f][2]benzofuran-7-ol |
| SMILES | CC1(C)O[C@H]2C[C@@H]3CO[C@@H](O)[C@@H]3C[C@H]2O1 |
| InChI | InChI=1S/C11H18O4/c1-11(2)14-8-3-6-5-13-10(12)7(6)4-9(8)15-11/h6-10,12H,3-5H2,1-2H3/t6-,7-,8+,9-,10-/m1/s1 |
| InChIKey | IUHOJLQSHSBFNB-HOTMZDKISA-N |
| XLogP | 0.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |