About 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol
4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol (PubChem CID 14226074) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol.
Analyze 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol?
The IUPAC name of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol (CID 14226074) is 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol.
What is the SMILES notation for 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol?
The canonical SMILES for 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol is CC1(C)OC2C3COC(O)C(C3)C2O1.
What is the InChIKey of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol?
The InChIKey is HATCITFOKHTYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-10(2)13-7-5-3-6(8(7)14-10)9(11)12-4-5/h5-9,11H,3-4H2,1-2H3.
What are the key properties of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol?
4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol has a molecular weight of 200.23 g/mol, XLogP of 0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-ol is sourced from PubChem (CID 14226074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).