C14H24O4 — CID 102157576
(1R,2R,6S,7S,9R)-4,4,7,12,12-pentamethyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 102157576) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (1R,2R,6S,7S,9R)-4,4,7,12,12-pentamethyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2R,6S,7S,9R)-4,4,7,12,12-pentamethyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 102157576 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (1R,2R,6S,7S,9R)-4,4,7,12,12-pentamethyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | C[C@H]1C[C@@H]2COC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H24O4/c1-8-6-9-7-15-13(2,3)17-11(9)12-10(8)16-14(4,5)18-12/h8-12H,6-7H2,1-5H3/t8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | XPABQVHJMAUHTD-RNWYCLNJSA-N |
| XLogP | 2.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |