C21H38O6 — CID 11003579
(4R,6S)-2,2,5-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-6-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1,3-dioxane (PubChem CID 11003579) has the molecular formula C21H38O6 and a molecular weight of 386.53 g/mol. Its IUPAC name is (4R,6S)-2,2,5-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-6-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1,3-dioxane.
| Compound Name | (4R,6S)-2,2,5-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-6-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 11003579 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (4R,6S)-2,2,5-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-6-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1,3-dioxane |
| SMILES | CC1[C@H]([C@@H]2OC(C)(C)OC[C@H]2C)OC(C)(C)O[C@@H]1[C@H]1OC(C)(C)OC[C@@H]1C |
| InChI | InChI=1S/C21H38O6/c1-12-10-22-19(4,5)24-15(12)17-14(3)18(27-21(8,9)26-17)16-13(2)11-23-20(6,7)25-16/h12-18H,10-11H2,1-9H3/t12-,13+,14?,15-,16+,17-,18+ |
| InChIKey | BQISNVZLSHTXJC-FHVASYHCSA-N |
| XLogP | 3.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |