C14H22O6 — CID 11254674
(1R,2S,6R,7S,8S,9S)-4,4,12,12-tetramethylspiro[3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-8,2'-oxirane]-7-ol (PubChem CID 11254674) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (1R,2S,6R,7S,8S,9S)-4,4,12,12-tetramethylspiro[3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-8,2'-oxirane]-7-ol.
| Compound Name | (1R,2S,6R,7S,8S,9S)-4,4,12,12-tetramethylspiro[3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-8,2'-oxirane]-7-ol |
|---|---|
| PubChem CID | 11254674 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1R,2S,6R,7S,8S,9S)-4,4,12,12-tetramethylspiro[3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-8,2'-oxirane]-7-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](O)[C@@]1(CO1)[C@H]1COC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H22O6/c1-12(2)16-5-7-8(18-12)9-10(20-13(3,4)19-9)11(15)14(7)6-17-14/h7-11,15H,5-6H2,1-4H3/t7-,8+,9-,10-,11-,14+/m0/s1 |
| InChIKey | AZUXBAWGXRNWDK-GLXDMVIJSA-N |
| XLogP | 0.42 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|