C22H33NO6 — CID 11315772
(1R,2S,6R,7S,8R,9S)-4,4,12,12-tetramethyl-8-[(2-phenylethylamino)methyl]-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-7,8-diol (PubChem CID 11315772) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is (1R,2S,6R,7S,8R,9S)-4,4,12,12-tetramethyl-8-[(2-phenylethylamino)methyl]-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-7,8-diol.
| Compound Name | (1R,2S,6R,7S,8R,9S)-4,4,12,12-tetramethyl-8-[(2-phenylethylamino)methyl]-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-7,8-diol |
|---|---|
| PubChem CID | 11315772 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (1R,2S,6R,7S,8R,9S)-4,4,12,12-tetramethyl-8-[(2-phenylethylamino)methyl]-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane-7,8-diol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](O)[C@](O)(CNCCc1ccccc1)[C@H]1COC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H33NO6/c1-20(2)26-12-15-16(27-20)17-18(29-21(3,4)28-17)19(24)22(15,25)13-23-11-10-14-8-6-5-7-9-14/h5-9,15-19,23-25H,10-13H2,1-4H3/t15-,16+,17-,18-,19-,22-/m0/s1 |
| InChIKey | XBVUNPVGJDWHPF-AUCYZEHXSA-N |
| XLogP | 1.21 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|