C23H31NO7S — CID 11374724
(2S)-2-[[2-[(3aS,4R,6S,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanethioyl]amino]-3-phenylpropanoic acid (PubChem CID 11374724) has the molecular formula C23H31NO7S and a molecular weight of 465.57 g/mol. Its IUPAC name is (2S)-2-[[2-[(3aS,4R,6S,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanethioyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-[(3aS,4R,6S,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanethioyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11374724 |
| Molecular Formula | C23H31NO7S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (2S)-2-[[2-[(3aS,4R,6S,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanethioyl]amino]-3-phenylpropanoic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](CC(=S)N[C@@H](Cc1ccccc1)C(=O)O)O[C@@H]2[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H31NO7S/c1-22(2)27-12-16(29-22)18-20-19(30-23(3,4)31-20)15(28-18)11-17(32)24-14(21(25)26)10-13-8-6-5-7-9-13/h5-9,14-16,18-20H,10-12H2,1-4H3,(H,24,32)(H,25,26)/t14-,15-,16+,18+,19+,20-/m0/s1 |
| InChIKey | RTGPRZGUFXIWTB-VBQNUUEISA-N |
| XLogP | 2.43 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|