C36H41NO9 — CID 11802145
ethyl (2S)-3-phenyl-2-[[4-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]benzoyl]amino]propanoate (PubChem CID 11802145) has the molecular formula C36H41NO9 and a molecular weight of 631.72 g/mol. Its IUPAC name is ethyl (2S)-3-phenyl-2-[[4-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]benzoyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-phenyl-2-[[4-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 11802145 |
| Molecular Formula | C36H41NO9 |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | ethyl (2S)-3-phenyl-2-[[4-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]benzoyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(-c2ccccc2O[C@H]2O[C@@H]3COC(C)(C)O[C@H]3[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C36H41NO9/c1-6-40-33(39)26(20-22-12-8-7-9-13-22)37-32(38)24-18-16-23(17-19-24)25-14-10-11-15-27(25)42-34-31-30(45-36(4,5)46-31)29-28(43-34)21-41-35(2,3)44-29/h7-19,26,28-31,34H,6,20-21H2,1-5H3,(H,37,38)/t26-,28+,29+,30-,31-,34-/m0/s1 |
| InChIKey | CTGBOXXTEBKUME-TZTQWZDTSA-N |
| XLogP | 5.03 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |