C31H41O9P — CID 10698603
(1R,2S,6S,7R,9R)-7-[2-[3-[(E)-3-diethoxyphosphorylprop-2-enyl]phenyl]phenoxy]-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 10698603) has the molecular formula C31H41O9P and a molecular weight of 588.63 g/mol. Its IUPAC name is (1R,2S,6S,7R,9R)-7-[2-[3-[(E)-3-diethoxyphosphorylprop-2-enyl]phenyl]phenoxy]-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2S,6S,7R,9R)-7-[2-[3-[(E)-3-diethoxyphosphorylprop-2-enyl]phenyl]phenoxy]-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 10698603 |
| Molecular Formula | C31H41O9P |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | (1R,2S,6S,7R,9R)-7-[2-[3-[(E)-3-diethoxyphosphorylprop-2-enyl]phenyl]phenoxy]-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CCOP(=O)(/C=C/Cc1cccc(-c2ccccc2O[C@H]2O[C@@H]3COC(C)(C)O[C@H]3[C@@H]3OC(C)(C)O[C@H]23)c1)OCC |
| InChI | InChI=1S/C31H41O9P/c1-7-34-41(32,35-8-2)18-12-14-21-13-11-15-22(19-21)23-16-9-10-17-24(23)36-29-28-27(39-31(5,6)40-28)26-25(37-29)20-33-30(3,4)38-26/h9-13,15-19,25-29H,7-8,14,20H2,1-6H3/b18-12+/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | YGTDUUCGDQEZTO-LKDJDJDOSA-N |
| XLogP | 6.45 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|