C18H27NO6 — CID 10807978
(4aR,6S,7R,8R,8aS)-6-[2-[(dimethylamino)methyl]phenoxy]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 10807978) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aS)-6-[2-[(dimethylamino)methyl]phenoxy]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aS)-6-[2-[(dimethylamino)methyl]phenoxy]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 10807978 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (4aR,6S,7R,8R,8aS)-6-[2-[(dimethylamino)methyl]phenoxy]-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CN(C)Cc1ccccc1O[C@@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H27NO6/c1-18(2)22-10-13-16(25-18)14(20)15(21)17(24-13)23-12-8-6-5-7-11(12)9-19(3)4/h5-8,13-17,20-21H,9-10H2,1-4H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | PQPFLKBBKCXAQI-WRQOLXDDSA-N |
| XLogP | 0.73 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |