About 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane
7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane (PubChem CID 121458537) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane.
Molecular Properties
| Compound Name | 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane |
| PubChem CID | 121458537 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane |
| SMILES | C1CC1C1CC(C2CO2)C2C1CC1OC12 |
| InChI | InChI=1S/C13H18O2/c1-2-6(1)7-3-9(11-5-14-11)12-8(7)4-10-13(12)15-10/h6-13H,1-5H2 |
| InChIKey | YPFBVCCIDVRFMN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane?
The IUPAC name of 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane (CID 121458537) is 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane.
What is the SMILES notation for 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane?
The canonical SMILES for 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane is C1CC1C1CC(C2CO2)C2C1CC1OC12.
What is the InChIKey of 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane?
The InChIKey is YPFBVCCIDVRFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-2-6(1)7-3-9(11-5-14-11)12-8(7)4-10-13(12)15-10/h6-13H,1-5H2.
What are the key properties of 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane?
7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane has a molecular weight of 206.28 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropyl-9-(oxiran-2-yl)-3-oxatricyclo[4.3.0.02,4]nonane is sourced from PubChem (CID 121458537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).