C5H6S3 — CID 22931464
2,4,8-trithiatricyclo[5.1.0.03,5]octane (PubChem CID 22931464) has the molecular formula C5H6S3 and a molecular weight of 162.30 g/mol. Its IUPAC name is 2,4,8-trithiatricyclo[5.1.0.03,5]octane.
| Compound Name | 2,4,8-trithiatricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 22931464 |
| Molecular Formula | C5H6S3 |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 161.96 |
| IUPAC Name | 2,4,8-trithiatricyclo[5.1.0.03,5]octane |
| SMILES | C1C2SC2SC2SC12 |
| InChI | InChI=1S/C5H6S3/c1-2-4(6-2)8-5-3(1)7-5/h2-5H,1H2 |
| InChIKey | JKEGMGQXXWQXQZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|