C11H14OS3 — CID 11097258
(1R,2S,3S,4S,6R,7R,9S,11S)-1,11-dimethyl-12-oxa-8,10,13-trithiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane (PubChem CID 11097258) has the molecular formula C11H14OS3 and a molecular weight of 258.43 g/mol. Its IUPAC name is (1R,2S,3S,4S,6R,7R,9S,11S)-1,11-dimethyl-12-oxa-8,10,13-trithiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane.
| Compound Name | (1R,2S,3S,4S,6R,7R,9S,11S)-1,11-dimethyl-12-oxa-8,10,13-trithiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
|---|---|
| PubChem CID | 11097258 |
| Molecular Formula | C11H14OS3 |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (1R,2S,3S,4S,6R,7R,9S,11S)-1,11-dimethyl-12-oxa-8,10,13-trithiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
| SMILES | C[C@]12O[C@]3(C)S[C@@H]4S[C@H](S1)[C@H]1C[C@@H]4[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C11H14OS3/c1-10-6-4-3-5-7(6)11(2,12-10)15-9(5)13-8(4)14-10/h4-9H,3H2,1-2H3/t4-,5+,6-,7-,8+,9-,10-,11+/m1/s1 |
| InChIKey | BKZHSYAJOWJYQF-YUUPWPORSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |