C12H14O3S2 — CID 85300047
3,5-dimethyl-2,4,6-trioxa-8,15-dithiahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane (PubChem CID 85300047) has the molecular formula C12H14O3S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3,5-dimethyl-2,4,6-trioxa-8,15-dithiahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane.
| Compound Name | 3,5-dimethyl-2,4,6-trioxa-8,15-dithiahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane |
|---|---|
| PubChem CID | 85300047 |
| Molecular Formula | C12H14O3S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3,5-dimethyl-2,4,6-trioxa-8,15-dithiahexacyclo[7.5.1.03,13.05,12.07,11.010,14]pentadecane |
| SMILES | CC12OC3SC4SC5OC(C)(O1)C1C5C4C3C12 |
| InChI | InChI=1S/C12H14O3S2/c1-11-6-4-3-5-7(6)12(2,15-11)14-9(5)17-10(3)16-8(4)13-11/h3-10H,1-2H3 |
| InChIKey | VMRRXGOUDLYAAD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |