C13H20O5 — CID 10729752
(1S,3R,4R,6S,7S,9R,10R,11R)-3,7-dimethoxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane (PubChem CID 10729752) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1S,3R,4R,6S,7S,9R,10R,11R)-3,7-dimethoxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane.
| Compound Name | (1S,3R,4R,6S,7S,9R,10R,11R)-3,7-dimethoxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane |
|---|---|
| PubChem CID | 10729752 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1S,3R,4R,6S,7S,9R,10R,11R)-3,7-dimethoxy-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane |
| SMILES | CO[C@H]1O[C@]2(C)O[C@]3(C)O[C@@H](OC)[C@@H]4C[C@H]1[C@@H]2[C@@H]43 |
| InChI | InChI=1S/C13H20O5/c1-12-8-6(10(14-3)16-12)5-7-9(8)13(2,18-12)17-11(7)15-4/h6-11H,5H2,1-4H3/t6-,7+,8-,9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | BEFUQVCABOGBAD-PLMFTYDBSA-N |
| XLogP | 1.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |