C18H30O6 — CID 54754002
(1S,3S,4R,6S,7S,9R,10S,11R)-1,9-dibutyl-3-hydroperoxy-7-methoxy-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane (PubChem CID 54754002) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is (1S,3S,4R,6S,7S,9R,10S,11R)-1,9-dibutyl-3-hydroperoxy-7-methoxy-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane.
| Compound Name | (1S,3S,4R,6S,7S,9R,10S,11R)-1,9-dibutyl-3-hydroperoxy-7-methoxy-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane |
|---|---|
| PubChem CID | 54754002 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (1S,3S,4R,6S,7S,9R,10S,11R)-1,9-dibutyl-3-hydroperoxy-7-methoxy-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane |
| SMILES | CCCC[C@]12O[C@@H](OO)[C@@H]3C[C@@H]4[C@@H](OC)O[C@](CCCC)(O1)[C@@H]4[C@@H]32 |
| InChI | InChI=1S/C18H30O6/c1-4-6-8-17-13-11(15(20-3)21-17)10-12-14(13)18(24-17,9-7-5-2)22-16(12)23-19/h11-16,19H,4-10H2,1-3H3/t11-,12+,13-,14+,15-,16-,17+,18-/m0/s1 |
| InChIKey | IDVSNGDAPJDVEJ-UBTCAPSASA-N |
| XLogP | 3.51 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|