C32H64O2 — CID 90108477
2,2,3,3,5,5,6-heptabutyl-1,4-dioxane (PubChem CID 90108477) has the molecular formula C32H64O2 and a molecular weight of 480.86 g/mol. Its IUPAC name is 2,2,3,3,5,5,6-heptabutyl-1,4-dioxane.
| Compound Name | 2,2,3,3,5,5,6-heptabutyl-1,4-dioxane |
|---|---|
| PubChem CID | 90108477 |
| Molecular Formula | C32H64O2 |
| Molecular Weight | 480.86 g/mol |
| Exact Mass | 480.49 |
| IUPAC Name | 2,2,3,3,5,5,6-heptabutyl-1,4-dioxane |
| SMILES | CCCCC1OC(CCCC)(CCCC)C(CCCC)(CCCC)OC1(CCCC)CCCC |
| InChI | InChI=1S/C32H64O2/c1-8-15-22-29-30(23-16-9-2,24-17-10-3)34-32(27-20-13-6,28-21-14-7)31(33-29,25-18-11-4)26-19-12-5/h29H,8-28H2,1-7H3 |
| InChIKey | CWRUVCPICAQOSI-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.86 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |