C12H22O — CID 154719468
(3R)-2,2-dibutyl-3-ethenyloxirane (PubChem CID 154719468) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (3R)-2,2-dibutyl-3-ethenyloxirane.
| Compound Name | (3R)-2,2-dibutyl-3-ethenyloxirane |
|---|---|
| PubChem CID | 154719468 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (3R)-2,2-dibutyl-3-ethenyloxirane |
| SMILES | C=C[C@H]1OC1(CCCC)CCCC |
| InChI | InChI=1S/C12H22O/c1-4-7-9-12(10-8-5-2)11(6-3)13-12/h6,11H,3-5,7-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | JKRTVLVLJZBWNJ-LLVKDONJSA-N |
| XLogP | 3.69 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|