About 2-ethenyl-3-octyloxirane
2-ethenyl-3-octyloxirane (PubChem CID 11332855) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-ethenyl-3-octyloxirane.
Molecular Properties
| Compound Name | 2-ethenyl-3-octyloxirane |
| PubChem CID | 11332855 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-ethenyl-3-octyloxirane |
| SMILES | C=CC1OC1CCCCCCCC |
| InChI | InChI=1S/C12H22O/c1-3-5-6-7-8-9-10-12-11(4-2)13-12/h4,11-12H,2-3,5-10H2,1H3 |
| InChIKey | AYJGCLSPYHBBDH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3-octyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3-octyloxirane?
The IUPAC name of 2-ethenyl-3-octyloxirane (CID 11332855) is 2-ethenyl-3-octyloxirane.
What is the SMILES notation for 2-ethenyl-3-octyloxirane?
The canonical SMILES for 2-ethenyl-3-octyloxirane is C=CC1OC1CCCCCCCC.
What is the InChIKey of 2-ethenyl-3-octyloxirane?
The InChIKey is AYJGCLSPYHBBDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-3-5-6-7-8-9-10-12-11(4-2)13-12/h4,11-12H,2-3,5-10H2,1H3.
What are the key properties of 2-ethenyl-3-octyloxirane?
2-ethenyl-3-octyloxirane has a molecular weight of 182.31 g/mol, XLogP of 3.69, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3-octyloxirane is sourced from PubChem (CID 11332855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).