C14H20O5 — CID 22869690
(1S,4S,6R,7R,9S,10R,11S)-9-butyl-7-hydroxy-1-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one (PubChem CID 22869690) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,4S,6R,7R,9S,10R,11S)-9-butyl-7-hydroxy-1-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one.
| Compound Name | (1S,4S,6R,7R,9S,10R,11S)-9-butyl-7-hydroxy-1-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
|---|---|
| PubChem CID | 22869690 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1S,4S,6R,7R,9S,10R,11S)-9-butyl-7-hydroxy-1-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
| SMILES | CCCC[C@]12O[C@@H](O)[C@@H]3C[C@@H]4C(=O)O[C@](C)(O1)[C@H]4[C@@H]32 |
| InChI | InChI=1S/C14H20O5/c1-3-4-5-14-10-8(12(16)18-14)6-7-9(10)13(2,19-14)17-11(7)15/h7-10,12,16H,3-6H2,1-2H3/t7-,8+,9+,10+,12+,13+,14-/m0/s1 |
| InChIKey | YZALNLJKCURYKW-PZHSNIEUSA-N |
| XLogP | 1.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |