C11H14S4 — CID 73209756
1,11-dimethyl-8,10,12,13-tetrathiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane (PubChem CID 73209756) has the molecular formula C11H14S4 and a molecular weight of 274.50 g/mol. Its IUPAC name is 1,11-dimethyl-8,10,12,13-tetrathiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane.
| Compound Name | 1,11-dimethyl-8,10,12,13-tetrathiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
|---|---|
| PubChem CID | 73209756 |
| Molecular Formula | C11H14S4 |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1,11-dimethyl-8,10,12,13-tetrathiapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
| SMILES | CC12SC3SC4SC(C)(S1)C1C4CC3C12 |
| InChI | InChI=1S/C11H14S4/c1-10-6-4-3-5-7(6)11(2,15-10)14-9(5)12-8(4)13-10/h4-9H,3H2,1-2H3 |
| InChIKey | LCLLEGMCGPNTET-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |