C7H10S5 — CID 139938321
3,5-bis(thiiran-2-yl)-1,2,4-trithiane (PubChem CID 139938321) has the molecular formula C7H10S5 and a molecular weight of 254.49 g/mol. Its IUPAC name is 3,5-bis(thiiran-2-yl)-1,2,4-trithiane.
| Compound Name | 3,5-bis(thiiran-2-yl)-1,2,4-trithiane |
|---|---|
| PubChem CID | 139938321 |
| Molecular Formula | C7H10S5 |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | 3,5-bis(thiiran-2-yl)-1,2,4-trithiane |
| SMILES | C1SC1C1CSSC(C2CS2)S1 |
| InChI | InChI=1S/C7H10S5/c1-4(8-1)5-3-10-12-7(11-5)6-2-9-6/h4-7H,1-3H2 |
| InChIKey | NAXLLOGEMUDQOB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|