C6H12S3 — CID 6428999
3-ethyl-5-methyl-1,2,4-trithiane (PubChem CID 6428999) has the molecular formula C6H12S3 and a molecular weight of 180.36 g/mol. Its IUPAC name is 3-ethyl-5-methyl-1,2,4-trithiane.
| Compound Name | 3-ethyl-5-methyl-1,2,4-trithiane |
|---|---|
| PubChem CID | 6428999 |
| Molecular Formula | C6H12S3 |
| Molecular Weight | 180.36 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 3-ethyl-5-methyl-1,2,4-trithiane |
| SMILES | CCC1SSCC(C)S1 |
| InChI | InChI=1S/C6H12S3/c1-3-6-8-5(2)4-7-9-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | ISWSBYSCAJHJQU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|