About 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane
3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane (PubChem CID 4522991) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane.
Analyze 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane?
The IUPAC name of 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane (CID 4522991) is 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane.
What is the SMILES notation for 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane?
The canonical SMILES for 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane is C1OCC2SC3COCOC3C2O1.
What is the InChIKey of 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane?
The InChIKey is ZOASYXZHAJMTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4S/c1-5-7(11-3-9-1)8-6(13-5)2-10-4-12-8/h5-8H,1-4H2.
What are the key properties of 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane?
3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane has a molecular weight of 204.25 g/mol, XLogP of 0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane is sourced from PubChem (CID 4522991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).