C5H8-2 — CID 58892113
1,2-dimethanidylcyclopropane (PubChem CID 58892113) has the molecular formula C5H8-2 and a molecular weight of 68.12 g/mol. Its IUPAC name is 1,2-dimethanidylcyclopropane.
| Compound Name | 1,2-dimethanidylcyclopropane |
|---|---|
| PubChem CID | 58892113 |
| Molecular Formula | C5H8-2 |
| Molecular Weight | 68.12 g/mol |
| Exact Mass | 68.06 |
| IUPAC Name | 1,2-dimethanidylcyclopropane |
| SMILES | [CH2-]C1CC1[CH2-] |
| InChI | InChI=1S/C5H8/c1-4-3-5(4)2/h4-5H,1-3H2/q-2 |
| InChIKey | VIUZUVBNZNQZPH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 68.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|