About 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+)
3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) (PubChem CID 174116308) has the molecular formula C7H13NV
and a molecular weight of 162.13 g/mol. Its IUPAC name is 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+).
Molecular Properties
| Compound Name | 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) |
| PubChem CID | 174116308 |
| Molecular Formula | C7H13NV |
| Molecular Weight | 162.13 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) |
| SMILES | [CH2-]C1CN(C)CC1[CH2-].[V+2] |
| InChI | InChI=1S/C7H13N.V/c1-6-4-8(3)5-7(6)2;/h6-7H,1-2,4-5H2,3H3;/q-2;+2 |
| InChIKey | SDCUJCWZNLAPRG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.13 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+)?
The IUPAC name of 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) (CID 174116308) is 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+).
What is the SMILES notation for 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+)?
The canonical SMILES for 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) is [CH2-]C1CN(C)CC1[CH2-].[V+2].
What is the InChIKey of 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+)?
The InChIKey is SDCUJCWZNLAPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.V/c1-6-4-8(3)5-7(6)2;/h6-7H,1-2,4-5H2,3H3;/q-2;+2.
What are the key properties of 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+)?
3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) has a molecular weight of 162.13 g/mol, XLogP of 0.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) is sourced from PubChem (CID 174116308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).