C7H13NV — CID 174116308
3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) (PubChem CID 174116308) has the molecular formula C7H13NV and a molecular weight of 162.13 g/mol. Its IUPAC name is 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+).
| Compound Name | 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) |
|---|---|
| PubChem CID | 174116308 |
| Molecular Formula | C7H13NV |
| Molecular Weight | 162.13 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 3,4-dimethanidyl-1-methylpyrrolidine;vanadium(2+) |
| SMILES | [CH2-]C1CN(C)CC1[CH2-].[V+2] |
| InChI | InChI=1S/C7H13N.V/c1-6-4-8(3)5-7(6)2;/h6-7H,1-2,4-5H2,3H3;/q-2;+2 |
| InChIKey | SDCUJCWZNLAPRG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.13 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|