About 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium
4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium (PubChem CID 177009918) has the molecular formula C10H20F2NNo-
and a molecular weight of 451.27 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium |
| PubChem CID | 177009918 |
| Molecular Formula | C10H20F2NNo- |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium |
| SMILES | CC.[CH2-]C1CN(C)CCC1C(F)F.[No] |
| InChI | InChI=1S/C8H14F2N.C2H6.No/c1-6-5-11(2)4-3-7(6)8(9)10;1-2;/h6-8H,1,3-5H2,2H3;1-2H3;/q-1;; |
| InChIKey | VPVKUHBZKUJUMT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium?
The IUPAC name of 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium (CID 177009918) is 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium.
What is the SMILES notation for 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium?
The canonical SMILES for 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium is CC.[CH2-]C1CN(C)CCC1C(F)F.[No].
What is the InChIKey of 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium?
The InChIKey is VPVKUHBZKUJUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N.C2H6.No/c1-6-5-11(2)4-3-7(6)8(9)10;1-2;/h6-8H,1,3-5H2,2H3;1-2H3;/q-1;;.
What are the key properties of 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium?
4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium has a molecular weight of 451.27 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-3-methanidyl-1-methylpiperidine;ethane;nobelium is sourced from PubChem (CID 177009918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).