About zinc methanidylcyclopropane
zinc methanidylcyclopropane (PubChem CID 142531158) has the molecular formula C8H14Zn
and a molecular weight of 175.59 g/mol. Its IUPAC name is zinc methanidylcyclopropane.
Molecular Properties
| Compound Name | zinc methanidylcyclopropane |
|---|
| PubChem CID | 142531158 |
|---|
| Molecular Formula | C8H14Zn |
|---|
| Molecular Weight | 175.59 g/mol |
|---|
| Exact Mass | 174.04 |
|---|
| IUPAC Name | zinc methanidylcyclopropane |
|---|
| SMILES | [CH2-]C1CC1.[CH2-]C1CC1.[Zn+2] |
|---|
| InChI | InChI=1S/2C4H7.Zn/c2*1-4-2-3-4;/h2*4H,1-3H2;/q2*-1;+2 |
|---|
| InChIKey | MHJALYFOUFLVEM-UHFFFAOYSA-N |
|---|
| XLogP | 2.46 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 175.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc methanidylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc methanidylcyclopropane?
The IUPAC name of zinc methanidylcyclopropane (CID 142531158) is zinc methanidylcyclopropane.
What is the SMILES notation for zinc methanidylcyclopropane?
The canonical SMILES for zinc methanidylcyclopropane is [CH2-]C1CC1.[CH2-]C1CC1.[Zn+2].
What is the InChIKey of zinc methanidylcyclopropane?
The InChIKey is MHJALYFOUFLVEM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H7.Zn/c2*1-4-2-3-4;/h2*4H,1-3H2;/q2*-1;+2.
What are the key properties of zinc methanidylcyclopropane?
zinc methanidylcyclopropane has a molecular weight of 175.59 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc methanidylcyclopropane is sourced from PubChem (CID 142531158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).