About methanidylcyclohexane;2-methylpropane;tungsten(2+)
methanidylcyclohexane;2-methylpropane;tungsten(2+) (PubChem CID 59169951) has the molecular formula C11H22W
and a molecular weight of 338.14 g/mol. Its IUPAC name is methanidylcyclohexane;2-methylpropane;tungsten(2+).
Molecular Properties
| Compound Name | methanidylcyclohexane;2-methylpropane;tungsten(2+) |
| PubChem CID | 59169951 |
| Molecular Formula | C11H22W |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | methanidylcyclohexane;2-methylpropane;tungsten(2+) |
| SMILES | C[C-](C)C.[CH2-]C1CCCCC1.[W+2] |
| InChI | InChI=1S/C7H13.C4H9.W/c1-7-5-3-2-4-6-7;1-4(2)3;/h7H,1-6H2;1-3H3;/q2*-1;+2 |
| InChIKey | QABXFHOHKLFDMW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methanidylcyclohexane;2-methylpropane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidylcyclohexane;2-methylpropane;tungsten(2+)?
The IUPAC name of methanidylcyclohexane;2-methylpropane;tungsten(2+) (CID 59169951) is methanidylcyclohexane;2-methylpropane;tungsten(2+).
What is the SMILES notation for methanidylcyclohexane;2-methylpropane;tungsten(2+)?
The canonical SMILES for methanidylcyclohexane;2-methylpropane;tungsten(2+) is C[C-](C)C.[CH2-]C1CCCCC1.[W+2].
What is the InChIKey of methanidylcyclohexane;2-methylpropane;tungsten(2+)?
The InChIKey is QABXFHOHKLFDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13.C4H9.W/c1-7-5-3-2-4-6-7;1-4(2)3;/h7H,1-6H2;1-3H3;/q2*-1;+2.
What are the key properties of methanidylcyclohexane;2-methylpropane;tungsten(2+)?
methanidylcyclohexane;2-methylpropane;tungsten(2+) has a molecular weight of 338.14 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methanidylcyclohexane;2-methylpropane;tungsten(2+) is sourced from PubChem (CID 59169951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).