About 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+)
1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) (PubChem CID 21015071) has the molecular formula C21H37Y+2
and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+).
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) |
| PubChem CID | 21015071 |
| Molecular Formula | C21H37Y+2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) |
| SMILES | [CH2-]C1CCC(CC2CCC(CC3CCCCC3)CC2)CC1.[Y+3] |
| InChI | InChI=1S/C21H37.Y/c1-17-7-9-19(10-8-17)16-21-13-11-20(12-14-21)15-18-5-3-2-4-6-18;/h17-21H,1-16H2;/q-1;+3 |
| InChIKey | KEUWIMAHBOERCN-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+)?
The IUPAC name of 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) (CID 21015071) is 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+).
What is the SMILES notation for 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+)?
The canonical SMILES for 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) is [CH2-]C1CCC(CC2CCC(CC3CCCCC3)CC2)CC1.[Y+3].
What is the InChIKey of 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+)?
The InChIKey is KEUWIMAHBOERCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37.Y/c1-17-7-9-19(10-8-17)16-21-13-11-20(12-14-21)15-18-5-3-2-4-6-18;/h17-21H,1-16H2;/q-1;+3.
What are the key properties of 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+)?
1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) has a molecular weight of 378.43 g/mol, XLogP of 6.79, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)-4-[(4-methanidylcyclohexyl)methyl]cyclohexane;yttrium(3+) is sourced from PubChem (CID 21015071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).