C8H13ClO — CID 11194509
8-chloro-7,8-dideuteriobicyclo[4.2.0]octan-7-ol (PubChem CID 11194509) has the molecular formula C8H13ClO and a molecular weight of 162.66 g/mol. Its IUPAC name is 8-chloro-7,8-dideuteriobicyclo[4.2.0]octan-7-ol.
| Compound Name | 8-chloro-7,8-dideuteriobicyclo[4.2.0]octan-7-ol |
|---|---|
| PubChem CID | 11194509 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 8-chloro-7,8-dideuteriobicyclo[4.2.0]octan-7-ol |
| SMILES | [2H]C1(O)C2CCCCC2C1([2H])Cl |
| InChI | InChI=1S/C8H13ClO/c9-7-5-3-1-2-4-6(5)8(7)10/h5-8,10H,1-4H2/i7D,8D |
| InChIKey | GVUYUFTUDOWKOM-QTQOOCSTSA-N |
| XLogP | 1.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|