About 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane
1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane (PubChem CID 90765182) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane.
Analyze 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane?
The IUPAC name of 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane (CID 90765182) is 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane.
What is the SMILES notation for 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane?
The canonical SMILES for 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane is C1C2CC3CC(C4C5CC6CC(C5)C4C6)(C2)CC13.
What is the InChIKey of 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane?
The InChIKey is PZQDDNMUOLYOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26/c1-10-2-13-6-12(1)16(5-10)17(13)18-7-11-3-14(8-18)15(4-11)9-18/h10-17H,1-9H2.
What are the key properties of 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane?
1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane has a molecular weight of 242.41 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tricyclo[3.3.1.03,7]nonanyl)tricyclo[3.3.1.03,7]nonane is sourced from PubChem (CID 90765182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).